-
Read the molecule from a intact smiles:
``` python
m = Chem.MolFromSmiles('c1ccc(/C2=c3\cccc\c3=C(c3ccccc3)\[NH+]=c3\cccc/c3=[NH+]/2)cc1')
smi = Chem.MolToSmiles(m, True)
smi --> 'c1ccc(/C2=c3\cccc…
-
Hi,
Do is it possible to get units of values in the table ? As an example, can I get the units for the "distance" and "masse" fields here : https://fr.wikipedia.org/wiki/Discussion:Liste_des_trous_…
-
When I try to train a original SuperpointNet(without batch normal), but the training results will not converge. Is there any parameter I need to modified?
![image](https://github.com/eric-yyjau/pyto…
-
**Escopo**
Com a realização da I Oficina de Design e descobertas iniciais, é preciso compreender como se dará a contínua atualização de informações para melhorias nos processos e experiências no Mapas…
-
```
What steps will reproduce the problem?
1. Create a PieChart
2. Try to setLegendPosition to top with vertical layout (it's not possible)
What is the expected output? What do you see instead?
I wo…
-
```
What steps will reproduce the problem?
1. Create a PieChart
2. Try to setLegendPosition to top with vertical layout (it's not possible)
What is the expected output? What do you see instead?
I wo…
-
```
What steps will reproduce the problem?
1. Create a PieChart
2. Try to setLegendPosition to top with vertical layout (it's not possible)
What is the expected output? What do you see instead?
I wo…
-
```
What steps will reproduce the problem?
1. Create a PieChart
2. Try to setLegendPosition to top with vertical layout (it's not possible)
What is the expected output? What do you see instead?
I wo…
-
```
What steps will reproduce the problem?
1. Create a PieChart
2. Try to setLegendPosition to top with vertical layout (it's not possible)
What is the expected output? What do you see instead?
I wo…
-
```
* checking data for non-ASCII characters ... NOTE
Note: found 179 marked UTF-8 strings
```
Here are the character that are causing problems in each data file:
```
> tools:::showNo…