10^6 error in PDep reactions from seed mechanisms?

Consider this rate from the RMG-Java database, Glarborg C2 seed mechanism

Unit:
A: mol/cm3/s
E: cal/mol

 CH3OH (+M) = CH3 + OH (+M)                 2.1E18  -0.6148  92540  0.0 0.0 0.0  
   N2/1/ H2/2/ H2O/6/ CH4/2/ CO/1.5/ CO2/2/ C2H6/3/
   LOW  /2.60E49 -8.80 101500/     
   TROE /0.7656 1910 59.51 9374/

This was imported into the RMG-Py database as

entry(
    index = 366,
    reactant1 = 
"""
CH3OH
1     C     0 {2,S}
2     O     0 {1,S}
""",
    product1 = 
"""
CH3
1     C     1
""",
    product2 = 
"""
OH
1     O     1
""",
    degeneracy = 1,
    kinetics = Troe(
        arrheniusHigh = Arrhenius(A=(2.1e+18,"s^-1"), n=-0.6148, Ea=(92540,"cal/mol"), T0=(1,"K")),
        arrheniusLow = Arrhenius(A=(2.6e+49,"s^-1"), n=-8.8, Ea=(101500,"cal/mol"), T0=1),
        efficiencies = {"C": 2, "C(=O)=O": 2, "CC": 3, "N#N": 1, "O": 6, "[C]=O": 1.5, "[H][H]": 2},
        alpha = 0.7656,
        T3 = (1910,"K"),
        T1 = (59.51,"K"),
        T2 = (9374,"K"),
    ),
    reference = None,
    referenceType = "",
    shortDesc = u"""""",
    longDesc = 
u"""

""",
    history = [
        ("2011-07-26","Richard West <rwest@mit.edu>","action","""Richard West <rwest@mit.edu> imported this entry from the old RMG database."""),
    ],
)

Note that arrheniusHigh and arrheniusLow both have the same units! Shouldn't arrheniusLow be cm3/mol/s ?

When this has been run through RMG-Py and ends up in a chemkin file, it reads:

REACTIONS    KCAL/MOLE   MOLES

! CH3OH(30) <=> CH3(24) + OH(15)
! Reaction index: Chemkin #366; RMG #355
! Library reaction: Glarborg/C2
! Flux pairs: CH3OH(30), CH3(24); CH3OH(30), OH(15)
! Kinetics comments:
CH3OH(30)(+M)=CH3(24)+OH(15)(+M)                    2.100e+18 -0.615    92.540   
CO2(20)/2.00/ N2/1.00/ CO(19)/1.50/ CH4(25)/2.00/ C2H6(35)/3.00/ H2O(4)/6.00/ H2(16)/2.00/ 
    LOW/ 2.600e+55 -8.800    101.500  /
    TROE/ 7.656e-01 1.91e+03  59.5      9.37e+03 /

Notice that LOW is now 6 orders of magnitude higher than it started. (Unless the chemkin default units is m? ...which it isn't)

ReactionMechanismGenerator / RMG-Py

10^6 error in PDep reactions from seed mechanisms? #96