Closed NadavQuris closed 1 year ago
Hi, I'm trying to get a molecule by InChI. I can't seem to filter anything correctly and I would appreciate help. What I'm doing is:
acetaminophen_inchi = "InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)" molecule = new_client.molecule aceta = molecule.filter(standard_inchi__iexact=acetaminophen_inchi)
Which returns 2331700 molecules (all of them?) What am I doing wrong?
Hi, I'm trying to get a molecule by InChI. I can't seem to filter anything correctly and I would appreciate help. What I'm doing is:
Which returns 2331700 molecules (all of them?) What am I doing wrong?