Closed j-wags closed 4 years ago
Yeah, here's a serialized OMM system showing duplicates of some impropers:
<Torsion k="8.368" p1="33" p2="32" p3="34" p4="35" periodicity="1" phase="0"/>
<Torsion k="10.46" p1="33" p2="32" p3="34" p4="35" periodicity="2" phase="3.141592653589793"/>
<Torsion k="8.368" p1="33" p2="32" p3="34" p4="35" periodicity="1" phase="0"/>
<Torsion k="10.46" p1="33" p2="32" p3="34" p4="35" periodicity="2" phase="3.141592653589793"/>
<Torsion k="10.46" p1="33" p2="32" p3="34" p4="36" periodicity="2" phase="3.141592653589793"/>
<Torsion k="10.46" p1="33" p2="32" p3="34" p4="36" periodicity="2" phase="3.141592653589793"/>
Actually, I'm seeing duplicates of all torsions (both propers and impropers)
I'm noticing that some impropers are defined with two perioditicty entires, both of which are the same
<Improper
smirks="[H][C@@:3]([C]=O)(C([H])([H])[S])[N:2]([H:4])[C:1](=O)C([H])([H])[H]"
periodicity1="1"
periodicity2="1"
phase1="180.0 * degree"
phase2="180.0 * degree"
k1="0.3666666666666667 * mole**-1 * kilocalorie"
k2="0.3666666666666667 * mole**-1 * kilocalorie"
id="A14SB-MainChain-CYX-C_CX_N_H"
idivf1="1.0"
idivf2="1.0">
</Improper>
This is probably because we're finding it twice in each structure (since each has two CYX
s), and we're getting confused and thinking it's a multi-term dihedral, so we're "stacking" them.
I am monitoring this as I develop the sugars workflow. I will probably be doing many of those calculations locally, until I have something I am happy with. It looks like we are close to having a solution to the CYX problem.
I suspect this is because impropers are being double-defined as a result of the symmetry of the SMARTS.